C13H15F4NO2 — CID 115351345
4-amino-3-[3-fluoro-5-(trifluoromethyl)phenyl]hexanoic acid (PubChem CID 115351345) has the molecular formula C13H15F4NO2 and a molecular weight of 293.26 g/mol. Its IUPAC name is 4-amino-3-[3-fluoro-5-(trifluoromethyl)phenyl]hexanoic acid.
| Compound Name | 4-amino-3-[3-fluoro-5-(trifluoromethyl)phenyl]hexanoic acid |
|---|---|
| PubChem CID | 115351345 |
| Molecular Formula | C13H15F4NO2 |
| Molecular Weight | 293.26 g/mol |
| Exact Mass | 293.10 |
| IUPAC Name | 4-amino-3-[3-fluoro-5-(trifluoromethyl)phenyl]hexanoic acid |
| SMILES | CCC(N)C(CC(=O)O)c1cc(F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H15F4NO2/c1-2-11(18)10(6-12(19)20)7-3-8(13(15,16)17)5-9(14)4-7/h3-5,10-11H,2,6,18H2,1H3,(H,19,20) |
| InChIKey | QFCQIMQXXDHQER-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.26 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |