C12H13F4NO2 — CID 113292119
4-amino-3-[3-fluoro-5-(trifluoromethyl)phenyl]pentanoic acid (PubChem CID 113292119) has the molecular formula C12H13F4NO2 and a molecular weight of 279.23 g/mol. Its IUPAC name is 4-amino-3-[3-fluoro-5-(trifluoromethyl)phenyl]pentanoic acid.
| Compound Name | 4-amino-3-[3-fluoro-5-(trifluoromethyl)phenyl]pentanoic acid |
|---|---|
| PubChem CID | 113292119 |
| Molecular Formula | C12H13F4NO2 |
| Molecular Weight | 279.23 g/mol |
| Exact Mass | 279.09 |
| IUPAC Name | 4-amino-3-[3-fluoro-5-(trifluoromethyl)phenyl]pentanoic acid |
| SMILES | CC(N)C(CC(=O)O)c1cc(F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H13F4NO2/c1-6(17)10(5-11(18)19)7-2-8(12(14,15)16)4-9(13)3-7/h2-4,6,10H,5,17H2,1H3,(H,18,19) |
| InChIKey | ITSQJPUQBBWGDC-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.23 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |