C9H6F4O3 — CID 79021468
2-[3-fluoro-5-(trifluoromethyl)phenyl]-2-hydroxyacetic acid (PubChem CID 79021468) has the molecular formula C9H6F4O3 and a molecular weight of 238.14 g/mol. Its IUPAC name is 2-[3-fluoro-5-(trifluoromethyl)phenyl]-2-hydroxyacetic acid.
| Compound Name | 2-[3-fluoro-5-(trifluoromethyl)phenyl]-2-hydroxyacetic acid |
|---|---|
| PubChem CID | 79021468 |
| Molecular Formula | C9H6F4O3 |
| Molecular Weight | 238.14 g/mol |
| Exact Mass | 238.03 |
| IUPAC Name | 2-[3-fluoro-5-(trifluoromethyl)phenyl]-2-hydroxyacetic acid |
| SMILES | O=C(O)C(O)c1cc(F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C9H6F4O3/c10-6-2-4(7(14)8(15)16)1-5(3-6)9(11,12)13/h1-3,7,14H,(H,15,16) |
| InChIKey | NGPFOEDJOGFFEM-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.14 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |