About (2S)-2-(3,5-difluorophenyl)-2-hydroxyacetic acid;hydrochloride
(2S)-2-(3,5-difluorophenyl)-2-hydroxyacetic acid;hydrochloride (PubChem CID 70033662) has the molecular formula C8H7ClF2O3
and a molecular weight of 224.59 g/mol. Its IUPAC name is (2S)-2-(3,5-difluorophenyl)-2-hydroxyacetic acid;hydrochloride.
Analyze (2S)-2-(3,5-difluorophenyl)-2-hydroxyacetic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-(3,5-difluorophenyl)-2-hydroxyacetic acid;hydrochloride?
The IUPAC name of (2S)-2-(3,5-difluorophenyl)-2-hydroxyacetic acid;hydrochloride (CID 70033662) is (2S)-2-(3,5-difluorophenyl)-2-hydroxyacetic acid;hydrochloride.
What is the SMILES notation for (2S)-2-(3,5-difluorophenyl)-2-hydroxyacetic acid;hydrochloride?
The canonical SMILES for (2S)-2-(3,5-difluorophenyl)-2-hydroxyacetic acid;hydrochloride is Cl.O=C(O)[C@@H](O)c1cc(F)cc(F)c1.
What is the InChIKey of (2S)-2-(3,5-difluorophenyl)-2-hydroxyacetic acid;hydrochloride?
The InChIKey is KROMVYOMUVJPFA-FJXQXJEOSA-N. The full InChI is InChI=1S/C8H6F2O3.ClH/c9-5-1-4(2-6(10)3-5)7(11)8(12)13;/h1-3,7,11H,(H,12,13);1H/t7-;/m0./s1.
What are the key properties of (2S)-2-(3,5-difluorophenyl)-2-hydroxyacetic acid;hydrochloride?
(2S)-2-(3,5-difluorophenyl)-2-hydroxyacetic acid;hydrochloride has a molecular weight of 224.59 g/mol, XLogP of 1.50, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-(3,5-difluorophenyl)-2-hydroxyacetic acid;hydrochloride is sourced from PubChem (CID 70033662), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).