C8H5Cl2FO3 — CID 117349950
2-(3,5-dichloro-4-fluorophenyl)-2-hydroxyacetic acid (PubChem CID 117349950) has the molecular formula C8H5Cl2FO3 and a molecular weight of 239.03 g/mol. Its IUPAC name is 2-(3,5-dichloro-4-fluorophenyl)-2-hydroxyacetic acid.
| Compound Name | 2-(3,5-dichloro-4-fluorophenyl)-2-hydroxyacetic acid |
|---|---|
| PubChem CID | 117349950 |
| Molecular Formula | C8H5Cl2FO3 |
| Molecular Weight | 239.03 g/mol |
| Exact Mass | 237.96 |
| IUPAC Name | 2-(3,5-dichloro-4-fluorophenyl)-2-hydroxyacetic acid |
| SMILES | O=C(O)C(O)c1cc(Cl)c(F)c(Cl)c1 |
| InChI | InChI=1S/C8H5Cl2FO3/c9-4-1-3(7(12)8(13)14)2-5(10)6(4)11/h1-2,7,12H,(H,13,14) |
| InChIKey | VMXNXXKOFJHNDU-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.03 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|