C10H9Cl2FO3 — CID 117420956
ethyl 2-(3,5-dichloro-4-fluorophenyl)-2-hydroxyacetate (PubChem CID 117420956) has the molecular formula C10H9Cl2FO3 and a molecular weight of 267.08 g/mol. Its IUPAC name is ethyl 2-(3,5-dichloro-4-fluorophenyl)-2-hydroxyacetate.
| Compound Name | ethyl 2-(3,5-dichloro-4-fluorophenyl)-2-hydroxyacetate |
|---|---|
| PubChem CID | 117420956 |
| Molecular Formula | C10H9Cl2FO3 |
| Molecular Weight | 267.08 g/mol |
| Exact Mass | 265.99 |
| IUPAC Name | ethyl 2-(3,5-dichloro-4-fluorophenyl)-2-hydroxyacetate |
| SMILES | CCOC(=O)C(O)c1cc(Cl)c(F)c(Cl)c1 |
| InChI | InChI=1S/C10H9Cl2FO3/c1-2-16-10(15)9(14)5-3-6(11)8(13)7(12)4-5/h3-4,9,14H,2H2,1H3 |
| InChIKey | ZORAWNNJCVNETJ-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.08 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|