About 2-[3-(difluoromethyl)-4,5-difluorophenyl]-2-hydroxyacetic acid
2-[3-(difluoromethyl)-4,5-difluorophenyl]-2-hydroxyacetic acid (PubChem CID 131574789) has the molecular formula C9H6F4O3
and a molecular weight of 238.14 g/mol. Its IUPAC name is 2-[3-(difluoromethyl)-4,5-difluorophenyl]-2-hydroxyacetic acid.
Analyze 2-[3-(difluoromethyl)-4,5-difluorophenyl]-2-hydroxyacetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-(difluoromethyl)-4,5-difluorophenyl]-2-hydroxyacetic acid?
The IUPAC name of 2-[3-(difluoromethyl)-4,5-difluorophenyl]-2-hydroxyacetic acid (CID 131574789) is 2-[3-(difluoromethyl)-4,5-difluorophenyl]-2-hydroxyacetic acid.
What is the SMILES notation for 2-[3-(difluoromethyl)-4,5-difluorophenyl]-2-hydroxyacetic acid?
The canonical SMILES for 2-[3-(difluoromethyl)-4,5-difluorophenyl]-2-hydroxyacetic acid is O=C(O)C(O)c1cc(F)c(F)c(C(F)F)c1.
What is the InChIKey of 2-[3-(difluoromethyl)-4,5-difluorophenyl]-2-hydroxyacetic acid?
The InChIKey is SDPPODFNSACDDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6F4O3/c10-5-2-3(7(14)9(15)16)1-4(6(5)11)8(12)13/h1-2,7-8,14H,(H,15,16).
What are the key properties of 2-[3-(difluoromethyl)-4,5-difluorophenyl]-2-hydroxyacetic acid?
2-[3-(difluoromethyl)-4,5-difluorophenyl]-2-hydroxyacetic acid has a molecular weight of 238.14 g/mol, XLogP of 2.02, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(difluoromethyl)-4,5-difluorophenyl]-2-hydroxyacetic acid is sourced from PubChem (CID 131574789), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).