C8H5F3O4 — CID 117317411
2-hydroxy-2-(3,4,5-trifluoro-2-hydroxyphenyl)acetic acid (PubChem CID 117317411) has the molecular formula C8H5F3O4 and a molecular weight of 222.12 g/mol. Its IUPAC name is 2-hydroxy-2-(3,4,5-trifluoro-2-hydroxyphenyl)acetic acid.
| Compound Name | 2-hydroxy-2-(3,4,5-trifluoro-2-hydroxyphenyl)acetic acid |
|---|---|
| PubChem CID | 117317411 |
| Molecular Formula | C8H5F3O4 |
| Molecular Weight | 222.12 g/mol |
| Exact Mass | 222.01 |
| IUPAC Name | 2-hydroxy-2-(3,4,5-trifluoro-2-hydroxyphenyl)acetic acid |
| SMILES | O=C(O)C(O)c1cc(F)c(F)c(F)c1O |
| InChI | InChI=1S/C8H5F3O4/c9-3-1-2(7(13)8(14)15)6(12)5(11)4(3)10/h1,7,12-13H,(H,14,15) |
| InChIKey | VSPBCOKRQOMGLC-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.12 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|