C9H7F3O4 — CID 117344142
methyl 2-hydroxy-2-(3,4,5-trifluoro-2-hydroxyphenyl)acetate (PubChem CID 117344142) has the molecular formula C9H7F3O4 and a molecular weight of 236.14 g/mol. Its IUPAC name is methyl 2-hydroxy-2-(3,4,5-trifluoro-2-hydroxyphenyl)acetate.
| Compound Name | methyl 2-hydroxy-2-(3,4,5-trifluoro-2-hydroxyphenyl)acetate |
|---|---|
| PubChem CID | 117344142 |
| Molecular Formula | C9H7F3O4 |
| Molecular Weight | 236.14 g/mol |
| Exact Mass | 236.03 |
| IUPAC Name | methyl 2-hydroxy-2-(3,4,5-trifluoro-2-hydroxyphenyl)acetate |
| SMILES | COC(=O)C(O)c1cc(F)c(F)c(F)c1O |
| InChI | InChI=1S/C9H7F3O4/c1-16-9(15)8(14)3-2-4(10)5(11)6(12)7(3)13/h2,8,13-14H,1H3 |
| InChIKey | HERBDDMZGVHPGV-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.14 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|