C9H8BrFO5 — CID 117475569
methyl 2-(2-bromo-6-fluoro-3,4-dihydroxyphenyl)-2-hydroxyacetate (PubChem CID 117475569) has the molecular formula C9H8BrFO5 and a molecular weight of 295.06 g/mol. Its IUPAC name is methyl 2-(2-bromo-6-fluoro-3,4-dihydroxyphenyl)-2-hydroxyacetate.
| Compound Name | methyl 2-(2-bromo-6-fluoro-3,4-dihydroxyphenyl)-2-hydroxyacetate |
|---|---|
| PubChem CID | 117475569 |
| Molecular Formula | C9H8BrFO5 |
| Molecular Weight | 295.06 g/mol |
| Exact Mass | 293.95 |
| IUPAC Name | methyl 2-(2-bromo-6-fluoro-3,4-dihydroxyphenyl)-2-hydroxyacetate |
| SMILES | COC(=O)C(O)c1c(F)cc(O)c(O)c1Br |
| InChI | InChI=1S/C9H8BrFO5/c1-16-9(15)8(14)5-3(11)2-4(12)7(13)6(5)10/h2,8,12-14H,1H3 |
| InChIKey | CKSYZCFLTLOHSX-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.06 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|