C10H11ClO5 — CID 117369055
methyl 2-(2-chloro-3,4-dihydroxy-6-methylphenyl)-2-hydroxyacetate (PubChem CID 117369055) has the molecular formula C10H11ClO5 and a molecular weight of 246.65 g/mol. Its IUPAC name is methyl 2-(2-chloro-3,4-dihydroxy-6-methylphenyl)-2-hydroxyacetate.
| Compound Name | methyl 2-(2-chloro-3,4-dihydroxy-6-methylphenyl)-2-hydroxyacetate |
|---|---|
| PubChem CID | 117369055 |
| Molecular Formula | C10H11ClO5 |
| Molecular Weight | 246.65 g/mol |
| Exact Mass | 246.03 |
| IUPAC Name | methyl 2-(2-chloro-3,4-dihydroxy-6-methylphenyl)-2-hydroxyacetate |
| SMILES | COC(=O)C(O)c1c(C)cc(O)c(O)c1Cl |
| InChI | InChI=1S/C10H11ClO5/c1-4-3-5(12)8(13)7(11)6(4)9(14)10(15)16-2/h3,9,12-14H,1-2H3 |
| InChIKey | ABZZFYWJDBPUBM-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.65 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|