C10H11ClO5 — CID 117369069
2-(2-chloro-4-hydroxy-3-methoxy-6-methylphenyl)-2-hydroxyacetic acid (PubChem CID 117369069) has the molecular formula C10H11ClO5 and a molecular weight of 246.65 g/mol. Its IUPAC name is 2-(2-chloro-4-hydroxy-3-methoxy-6-methylphenyl)-2-hydroxyacetic acid.
| Compound Name | 2-(2-chloro-4-hydroxy-3-methoxy-6-methylphenyl)-2-hydroxyacetic acid |
|---|---|
| PubChem CID | 117369069 |
| Molecular Formula | C10H11ClO5 |
| Molecular Weight | 246.65 g/mol |
| Exact Mass | 246.03 |
| IUPAC Name | 2-(2-chloro-4-hydroxy-3-methoxy-6-methylphenyl)-2-hydroxyacetic acid |
| SMILES | COc1c(O)cc(C)c(C(O)C(=O)O)c1Cl |
| InChI | InChI=1S/C10H11ClO5/c1-4-3-5(12)9(16-2)7(11)6(4)8(13)10(14)15/h3,8,12-13H,1-2H3,(H,14,15) |
| InChIKey | XRESWEMYHBELQE-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.65 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |