C11H13FO3 — CID 117302719
methyl 2-(2-fluoro-3,5-dimethylphenyl)-2-hydroxyacetate (PubChem CID 117302719) has the molecular formula C11H13FO3 and a molecular weight of 212.22 g/mol. Its IUPAC name is methyl 2-(2-fluoro-3,5-dimethylphenyl)-2-hydroxyacetate.
| Compound Name | methyl 2-(2-fluoro-3,5-dimethylphenyl)-2-hydroxyacetate |
|---|---|
| PubChem CID | 117302719 |
| Molecular Formula | C11H13FO3 |
| Molecular Weight | 212.22 g/mol |
| Exact Mass | 212.08 |
| IUPAC Name | methyl 2-(2-fluoro-3,5-dimethylphenyl)-2-hydroxyacetate |
| SMILES | COC(=O)C(O)c1cc(C)cc(C)c1F |
| InChI | InChI=1S/C11H13FO3/c1-6-4-7(2)9(12)8(5-6)10(13)11(14)15-3/h4-5,10,13H,1-3H3 |
| InChIKey | JORMEPKCNGMJON-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.22 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |