C11H14FNO4 — CID 117359300
2-[5-[(dimethylamino)methyl]-3-fluoro-2-hydroxyphenyl]-2-hydroxyacetic acid (PubChem CID 117359300) has the molecular formula C11H14FNO4 and a molecular weight of 243.23 g/mol. Its IUPAC name is 2-[5-[(dimethylamino)methyl]-3-fluoro-2-hydroxyphenyl]-2-hydroxyacetic acid.
| Compound Name | 2-[5-[(dimethylamino)methyl]-3-fluoro-2-hydroxyphenyl]-2-hydroxyacetic acid |
|---|---|
| PubChem CID | 117359300 |
| Molecular Formula | C11H14FNO4 |
| Molecular Weight | 243.23 g/mol |
| Exact Mass | 243.09 |
| IUPAC Name | 2-[5-[(dimethylamino)methyl]-3-fluoro-2-hydroxyphenyl]-2-hydroxyacetic acid |
| SMILES | CN(C)Cc1cc(F)c(O)c(C(O)C(=O)O)c1 |
| InChI | InChI=1S/C11H14FNO4/c1-13(2)5-6-3-7(10(15)11(16)17)9(14)8(12)4-6/h3-4,10,14-15H,5H2,1-2H3,(H,16,17) |
| InChIKey | YFORSZKNWGIGFE-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.23 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |