C9H11F2NO — CID 82977010
4-[(dimethylamino)methyl]-2,6-difluorophenol (PubChem CID 82977010) has the molecular formula C9H11F2NO and a molecular weight of 187.19 g/mol. Its IUPAC name is 4-[(dimethylamino)methyl]-2,6-difluorophenol.
| Compound Name | 4-[(dimethylamino)methyl]-2,6-difluorophenol |
|---|---|
| PubChem CID | 82977010 |
| Molecular Formula | C9H11F2NO |
| Molecular Weight | 187.19 g/mol |
| Exact Mass | 187.08 |
| IUPAC Name | 4-[(dimethylamino)methyl]-2,6-difluorophenol |
| SMILES | CN(C)Cc1cc(F)c(O)c(F)c1 |
| InChI | InChI=1S/C9H11F2NO/c1-12(2)5-6-3-7(10)9(13)8(11)4-6/h3-4,13H,5H2,1-2H3 |
| InChIKey | ZYVKWTPKNAYOJG-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.19 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |