C13H19F2NO — CID 82975285
4-[[butyl(ethyl)amino]methyl]-2,6-difluorophenol (PubChem CID 82975285) has the molecular formula C13H19F2NO and a molecular weight of 243.30 g/mol. Its IUPAC name is 4-[[butyl(ethyl)amino]methyl]-2,6-difluorophenol.
| Compound Name | 4-[[butyl(ethyl)amino]methyl]-2,6-difluorophenol |
|---|---|
| PubChem CID | 82975285 |
| Molecular Formula | C13H19F2NO |
| Molecular Weight | 243.30 g/mol |
| Exact Mass | 243.14 |
| IUPAC Name | 4-[[butyl(ethyl)amino]methyl]-2,6-difluorophenol |
| SMILES | CCCCN(CC)Cc1cc(F)c(O)c(F)c1 |
| InChI | InChI=1S/C13H19F2NO/c1-3-5-6-16(4-2)9-10-7-11(14)13(17)12(15)8-10/h7-8,17H,3-6,9H2,1-2H3 |
| InChIKey | RSQFTTYBCIIVIU-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.30 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |