C80H132N4O4 — CID 132507482
5,11,17,23-tetrakis[(dihexylamino)methyl]pentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3,5,7(28),9,11,13(27),15(26),16,18,21(25),22-dodecaene-25,26,27,28-tetrol (PubChem CID 132507482) has the molecular formula C80H132N4O4 and a molecular weight of 1213.96 g/mol. Its IUPAC name is 5,11,17,23-tetrakis[(dihexylamino)methyl]pentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3,5,7(28),9,11,13(27),15(26),16,18,21(25),22-dodecaene-25,26,27,28-tetrol.
| Compound Name | 5,11,17,23-tetrakis[(dihexylamino)methyl]pentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3,5,7(28),9,11,13(27),15(26),16,18,21(25),22-dodecaene-25,26,27,28-tetrol |
|---|---|
| PubChem CID | 132507482 |
| Molecular Formula | C80H132N4O4 |
| Molecular Weight | 1213.96 g/mol |
| Exact Mass | 1213.02 |
| IUPAC Name | 5,11,17,23-tetrakis[(dihexylamino)methyl]pentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3,5,7(28),9,11,13(27),15(26),16,18,21(25),22-dodecaene-25,26,27,28-tetrol |
| SMILES | CCCCCCN(CCCCCC)Cc1cc2c(O)c(c1)Cc1cc(CN(CCCCCC)CCCCCC)cc(c1O)Cc1cc(CN(CCCCCC)CCCCCC)cc(c1O)Cc1cc(CN(CCCCCC)CCCCCC)cc(c1O)C2 |
| InChI | InChI=1S/C80H132N4O4/c1-9-17-25-33-41-81(42-34-26-18-10-2)61-65-49-69-57-71-51-66(62-82(43-35-27-19-11-3)44-36-28-20-12-4)53-73(78(71)86)59-75-55-68(64-84(47-39-31-23-15-7)48-40-32-24-16-8)56-76(80(75)88)60-74-54-67(52-72(79(74)87)58-70(50-65)77(69)85)63-83(45-37-29-21-13-5)46-38-30-22-14-6/h49-56,85-88H,9-48,57-64H2,1-8H3 |
| InChIKey | ANPWDEJNVARNFT-UHFFFAOYSA-N |
| XLogP | 21.04 |
| TPSA | 93.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 48 |
| Heavy Atoms | 88 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1213.96 |
| LogP ≤ 5 | 21.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|