C11H17NO3 — CID 10066574
4-[(dimethylamino)methyl]-2,6-dimethoxyphenol (PubChem CID 10066574) has the molecular formula C11H17NO3 and a molecular weight of 211.26 g/mol. Its IUPAC name is 4-[(dimethylamino)methyl]-2,6-dimethoxyphenol.
| Compound Name | 4-[(dimethylamino)methyl]-2,6-dimethoxyphenol |
|---|---|
| PubChem CID | 10066574 |
| Molecular Formula | C11H17NO3 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.12 |
| IUPAC Name | 4-[(dimethylamino)methyl]-2,6-dimethoxyphenol |
| SMILES | COc1cc(CN(C)C)cc(OC)c1O |
| InChI | InChI=1S/C11H17NO3/c1-12(2)7-8-5-9(14-3)11(13)10(6-8)15-4/h5-6,13H,7H2,1-4H3 |
| InChIKey | BUUOTZKSGGVVAY-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |