C18H19IN2O4 — CID 130383057
2-[5-[(dimethylamino)methyl]-2-hydroxy-3-methoxybenzoyl]-N-iodobenzamide (PubChem CID 130383057) has the molecular formula C18H19IN2O4 and a molecular weight of 454.26 g/mol. Its IUPAC name is 2-[5-[(dimethylamino)methyl]-2-hydroxy-3-methoxybenzoyl]-N-iodobenzamide.
| Compound Name | 2-[5-[(dimethylamino)methyl]-2-hydroxy-3-methoxybenzoyl]-N-iodobenzamide |
|---|---|
| PubChem CID | 130383057 |
| Molecular Formula | C18H19IN2O4 |
| Molecular Weight | 454.26 g/mol |
| Exact Mass | 454.04 |
| IUPAC Name | 2-[5-[(dimethylamino)methyl]-2-hydroxy-3-methoxybenzoyl]-N-iodobenzamide |
| SMILES | COc1cc(CN(C)C)cc(C(=O)c2ccccc2C(=O)NI)c1O |
| InChI | InChI=1S/C18H19IN2O4/c1-21(2)10-11-8-14(17(23)15(9-11)25-3)16(22)12-6-4-5-7-13(12)18(24)20-19/h4-9,23H,10H2,1-3H3,(H,20,24) |
| InChIKey | GRXWOMZYXCDWIB-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.26 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|