C18H20BrNO4 — CID 113095826
2-bromo-N-methyl-N-[(3,4,5-trimethoxyphenyl)methyl]benzamide (PubChem CID 113095826) has the molecular formula C18H20BrNO4 and a molecular weight of 394.27 g/mol. Its IUPAC name is 2-bromo-N-methyl-N-[(3,4,5-trimethoxyphenyl)methyl]benzamide.
| Compound Name | 2-bromo-N-methyl-N-[(3,4,5-trimethoxyphenyl)methyl]benzamide |
|---|---|
| PubChem CID | 113095826 |
| Molecular Formula | C18H20BrNO4 |
| Molecular Weight | 394.27 g/mol |
| Exact Mass | 393.06 |
| IUPAC Name | 2-bromo-N-methyl-N-[(3,4,5-trimethoxyphenyl)methyl]benzamide |
| SMILES | COc1cc(CN(C)C(=O)c2ccccc2Br)cc(OC)c1OC |
| InChI | InChI=1S/C18H20BrNO4/c1-20(18(21)13-7-5-6-8-14(13)19)11-12-9-15(22-2)17(24-4)16(10-12)23-3/h5-10H,11H2,1-4H3 |
| InChIKey | BNYZLKCGBVTDNI-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.27 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |