C15H26ClNO3 — CID 45259533
4-[(dipropylamino)methyl]-2,6-dimethoxyphenol;hydrochloride (PubChem CID 45259533) has the molecular formula C15H26ClNO3 and a molecular weight of 303.83 g/mol. Its IUPAC name is 4-[(dipropylamino)methyl]-2,6-dimethoxyphenol;hydrochloride.
| Compound Name | 4-[(dipropylamino)methyl]-2,6-dimethoxyphenol;hydrochloride |
|---|---|
| PubChem CID | 45259533 |
| Molecular Formula | C15H26ClNO3 |
| Molecular Weight | 303.83 g/mol |
| Exact Mass | 303.16 |
| IUPAC Name | 4-[(dipropylamino)methyl]-2,6-dimethoxyphenol;hydrochloride |
| SMILES | CCCN(CCC)Cc1cc(OC)c(O)c(OC)c1.Cl |
| InChI | InChI=1S/C15H25NO3.ClH/c1-5-7-16(8-6-2)11-12-9-13(18-3)15(17)14(10-12)19-4;/h9-10,17H,5-8,11H2,1-4H3;1H |
| InChIKey | LTKXBEYQMGLVDH-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.83 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |