C14H22BrNO2 — CID 80680489
N-(2-bromoethyl)-N-[(3,4-dimethoxyphenyl)methyl]propan-1-amine (PubChem CID 80680489) has the molecular formula C14H22BrNO2 and a molecular weight of 316.24 g/mol. Its IUPAC name is N-(2-bromoethyl)-N-[(3,4-dimethoxyphenyl)methyl]propan-1-amine.
| Compound Name | N-(2-bromoethyl)-N-[(3,4-dimethoxyphenyl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 80680489 |
| Molecular Formula | C14H22BrNO2 |
| Molecular Weight | 316.24 g/mol |
| Exact Mass | 315.08 |
| IUPAC Name | N-(2-bromoethyl)-N-[(3,4-dimethoxyphenyl)methyl]propan-1-amine |
| SMILES | CCCN(CCBr)Cc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C14H22BrNO2/c1-4-8-16(9-7-15)11-12-5-6-13(17-2)14(10-12)18-3/h5-6,10H,4,7-9,11H2,1-3H3 |
| InChIKey | DMPZBRWABXYPSG-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.24 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|