C14H21BrFNO — CID 80672187
N-(2-bromoethyl)-N-[(3-fluoro-4-methoxyphenyl)methyl]butan-1-amine (PubChem CID 80672187) has the molecular formula C14H21BrFNO and a molecular weight of 318.23 g/mol. Its IUPAC name is N-(2-bromoethyl)-N-[(3-fluoro-4-methoxyphenyl)methyl]butan-1-amine.
| Compound Name | N-(2-bromoethyl)-N-[(3-fluoro-4-methoxyphenyl)methyl]butan-1-amine |
|---|---|
| PubChem CID | 80672187 |
| Molecular Formula | C14H21BrFNO |
| Molecular Weight | 318.23 g/mol |
| Exact Mass | 317.08 |
| IUPAC Name | N-(2-bromoethyl)-N-[(3-fluoro-4-methoxyphenyl)methyl]butan-1-amine |
| SMILES | CCCCN(CCBr)Cc1ccc(OC)c(F)c1 |
| InChI | InChI=1S/C14H21BrFNO/c1-3-4-8-17(9-7-15)11-12-5-6-14(18-2)13(16)10-12/h5-6,10H,3-4,7-9,11H2,1-2H3 |
| InChIKey | PLGFDZMZPVEMNL-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.23 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|