C15H24BrN — CID 80672511
N-(2-bromoethyl)-N-[(3,4-dimethylphenyl)methyl]butan-1-amine (PubChem CID 80672511) has the molecular formula C15H24BrN and a molecular weight of 298.27 g/mol. Its IUPAC name is N-(2-bromoethyl)-N-[(3,4-dimethylphenyl)methyl]butan-1-amine.
| Compound Name | N-(2-bromoethyl)-N-[(3,4-dimethylphenyl)methyl]butan-1-amine |
|---|---|
| PubChem CID | 80672511 |
| Molecular Formula | C15H24BrN |
| Molecular Weight | 298.27 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | N-(2-bromoethyl)-N-[(3,4-dimethylphenyl)methyl]butan-1-amine |
| SMILES | CCCCN(CCBr)Cc1ccc(C)c(C)c1 |
| InChI | InChI=1S/C15H24BrN/c1-4-5-9-17(10-8-16)12-15-7-6-13(2)14(3)11-15/h6-7,11H,4-5,8-10,12H2,1-3H3 |
| InChIKey | VIQDLXYAXMDUOL-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.27 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|