C18H22ClN — CID 63388974
N-benzyl-2-chloro-N-[(3,4-dimethylphenyl)methyl]ethanamine (PubChem CID 63388974) has the molecular formula C18H22ClN and a molecular weight of 287.83 g/mol. Its IUPAC name is N-benzyl-2-chloro-N-[(3,4-dimethylphenyl)methyl]ethanamine.
| Compound Name | N-benzyl-2-chloro-N-[(3,4-dimethylphenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 63388974 |
| Molecular Formula | C18H22ClN |
| Molecular Weight | 287.83 g/mol |
| Exact Mass | 287.14 |
| IUPAC Name | N-benzyl-2-chloro-N-[(3,4-dimethylphenyl)methyl]ethanamine |
| SMILES | Cc1ccc(CN(CCCl)Cc2ccccc2)cc1C |
| InChI | InChI=1S/C18H22ClN/c1-15-8-9-18(12-16(15)2)14-20(11-10-19)13-17-6-4-3-5-7-17/h3-9,12H,10-11,13-14H2,1-2H3 |
| InChIKey | HKGZKDPGWZFXAV-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.83 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|