C20H28Cl4N2 — CID 138396514
N',N'-dibenzyl-N,N-bis(2-chloroethyl)ethane-1,2-diamine;dihydrochloride (PubChem CID 138396514) has the molecular formula C20H28Cl4N2 and a molecular weight of 438.27 g/mol. Its IUPAC name is N',N'-dibenzyl-N,N-bis(2-chloroethyl)ethane-1,2-diamine;dihydrochloride.
| Compound Name | N',N'-dibenzyl-N,N-bis(2-chloroethyl)ethane-1,2-diamine;dihydrochloride |
|---|---|
| PubChem CID | 138396514 |
| Molecular Formula | C20H28Cl4N2 |
| Molecular Weight | 438.27 g/mol |
| Exact Mass | 436.10 |
| IUPAC Name | N',N'-dibenzyl-N,N-bis(2-chloroethyl)ethane-1,2-diamine;dihydrochloride |
| SMILES | Cl.Cl.ClCCN(CCCl)CCN(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C20H26Cl2N2.2ClH/c21-11-13-23(14-12-22)15-16-24(17-19-7-3-1-4-8-19)18-20-9-5-2-6-10-20;;/h1-10H,11-18H2;2*1H |
| InChIKey | GHNNPZRVDMSHQT-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.27 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|