C16H20Cl2N2 — CID 3053599
N-benzyl-N-(2-chloroethyl)-2-pyridin-2-ylethanamine;hydrochloride (PubChem CID 3053599) has the molecular formula C16H20Cl2N2 and a molecular weight of 311.26 g/mol. Its IUPAC name is N-benzyl-N-(2-chloroethyl)-2-pyridin-2-ylethanamine;hydrochloride.
| Compound Name | N-benzyl-N-(2-chloroethyl)-2-pyridin-2-ylethanamine;hydrochloride |
|---|---|
| PubChem CID | 3053599 |
| Molecular Formula | C16H20Cl2N2 |
| Molecular Weight | 311.26 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | N-benzyl-N-(2-chloroethyl)-2-pyridin-2-ylethanamine;hydrochloride |
| SMILES | Cl.ClCCN(CCc1ccccn1)Cc1ccccc1 |
| InChI | InChI=1S/C16H19ClN2.ClH/c17-10-13-19(14-15-6-2-1-3-7-15)12-9-16-8-4-5-11-18-16;/h1-8,11H,9-10,12-14H2;1H |
| InChIKey | COBDDUOGKDHQNM-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.26 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|