C16H21ClN2 — CID 6460674
N',N'-dibenzylethane-1,2-diamine;hydrochloride (PubChem CID 6460674) has the molecular formula C16H21ClN2 and a molecular weight of 276.81 g/mol. Its IUPAC name is N',N'-dibenzylethane-1,2-diamine;hydrochloride.
| Compound Name | N',N'-dibenzylethane-1,2-diamine;hydrochloride |
|---|---|
| PubChem CID | 6460674 |
| Molecular Formula | C16H21ClN2 |
| Molecular Weight | 276.81 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | N',N'-dibenzylethane-1,2-diamine;hydrochloride |
| SMILES | Cl.NCCN(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C16H20N2.ClH/c17-11-12-18(13-15-7-3-1-4-8-15)14-16-9-5-2-6-10-16;/h1-10H,11-14,17H2;1H |
| InChIKey | JNUXLLGAZVAJMO-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.81 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |