C18H25N3 — CID 67896793
N',N'-dibenzylethane-1,2-diamine;ethenamine (PubChem CID 67896793) has the molecular formula C18H25N3 and a molecular weight of 283.42 g/mol. Its IUPAC name is N',N'-dibenzylethane-1,2-diamine;ethenamine.
| Compound Name | N',N'-dibenzylethane-1,2-diamine;ethenamine |
|---|---|
| PubChem CID | 67896793 |
| Molecular Formula | C18H25N3 |
| Molecular Weight | 283.42 g/mol |
| Exact Mass | 283.20 |
| IUPAC Name | N',N'-dibenzylethane-1,2-diamine;ethenamine |
| SMILES | C=CN.NCCN(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C16H20N2.C2H5N/c17-11-12-18(13-15-7-3-1-4-8-15)14-16-9-5-2-6-10-16;1-2-3/h1-10H,11-14,17H2;2H,1,3H2 |
| InChIKey | XYYWEJOZGWWOOY-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.42 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |