C18H20N2O — CID 104869951
N'-(1-benzofuran-3-ylmethyl)-N'-benzylethane-1,2-diamine (PubChem CID 104869951) has the molecular formula C18H20N2O and a molecular weight of 280.37 g/mol. Its IUPAC name is N'-(1-benzofuran-3-ylmethyl)-N'-benzylethane-1,2-diamine.
| Compound Name | N'-(1-benzofuran-3-ylmethyl)-N'-benzylethane-1,2-diamine |
|---|---|
| PubChem CID | 104869951 |
| Molecular Formula | C18H20N2O |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.16 |
| IUPAC Name | N'-(1-benzofuran-3-ylmethyl)-N'-benzylethane-1,2-diamine |
| SMILES | NCCN(Cc1ccccc1)Cc1coc2ccccc12 |
| InChI | InChI=1S/C18H20N2O/c19-10-11-20(12-15-6-2-1-3-7-15)13-16-14-21-18-9-5-4-8-17(16)18/h1-9,14H,10-13,19H2 |
| InChIKey | YFNJEWZCCHTCMX-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 42.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |