C13H24N2Si — CID 122164959
N'-benzyl-N'-(trimethylsilylmethyl)ethane-1,2-diamine (PubChem CID 122164959) has the molecular formula C13H24N2Si and a molecular weight of 236.43 g/mol. Its IUPAC name is N'-benzyl-N'-(trimethylsilylmethyl)ethane-1,2-diamine.
| Compound Name | N'-benzyl-N'-(trimethylsilylmethyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 122164959 |
| Molecular Formula | C13H24N2Si |
| Molecular Weight | 236.43 g/mol |
| Exact Mass | 236.17 |
| IUPAC Name | N'-benzyl-N'-(trimethylsilylmethyl)ethane-1,2-diamine |
| SMILES | C[Si](C)(C)CN(CCN)Cc1ccccc1 |
| InChI | InChI=1S/C13H24N2Si/c1-16(2,3)12-15(10-9-14)11-13-7-5-4-6-8-13/h4-8H,9-12,14H2,1-3H3 |
| InChIKey | OIVATBFWYNCAKW-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.43 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|