C12H16N4S — CID 130600119
N'-benzyl-N'-(thiadiazol-5-ylmethyl)ethane-1,2-diamine (PubChem CID 130600119) has the molecular formula C12H16N4S and a molecular weight of 248.36 g/mol. Its IUPAC name is N'-benzyl-N'-(thiadiazol-5-ylmethyl)ethane-1,2-diamine.
| Compound Name | N'-benzyl-N'-(thiadiazol-5-ylmethyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 130600119 |
| Molecular Formula | C12H16N4S |
| Molecular Weight | 248.36 g/mol |
| Exact Mass | 248.11 |
| IUPAC Name | N'-benzyl-N'-(thiadiazol-5-ylmethyl)ethane-1,2-diamine |
| SMILES | NCCN(Cc1ccccc1)Cc1cnns1 |
| InChI | InChI=1S/C12H16N4S/c13-6-7-16(10-12-8-14-15-17-12)9-11-4-2-1-3-5-11/h1-5,8H,6-7,9-10,13H2 |
| InChIKey | POYPEYOLGSOQFW-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.36 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |