C14H26N2Si — CID 155775630
(2R)-1-N-benzyl-1-N-(trimethylsilylmethyl)propane-1,2-diamine (PubChem CID 155775630) has the molecular formula C14H26N2Si and a molecular weight of 250.46 g/mol. Its IUPAC name is (2R)-1-N-benzyl-1-N-(trimethylsilylmethyl)propane-1,2-diamine.
| Compound Name | (2R)-1-N-benzyl-1-N-(trimethylsilylmethyl)propane-1,2-diamine |
|---|---|
| PubChem CID | 155775630 |
| Molecular Formula | C14H26N2Si |
| Molecular Weight | 250.46 g/mol |
| Exact Mass | 250.19 |
| IUPAC Name | (2R)-1-N-benzyl-1-N-(trimethylsilylmethyl)propane-1,2-diamine |
| SMILES | C[C@@H](N)CN(Cc1ccccc1)C[Si](C)(C)C |
| InChI | InChI=1S/C14H26N2Si/c1-13(15)10-16(12-17(2,3)4)11-14-8-6-5-7-9-14/h5-9,13H,10-12,15H2,1-4H3/t13-/m1/s1 |
| InChIKey | FETABIQTJHAXNZ-CYBMUJFWSA-N |
| XLogP | 2.71 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.46 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|