C13H24N4 — CID 101461919
N'-[2-[2-aminoethyl(benzyl)amino]ethyl]ethane-1,2-diamine (PubChem CID 101461919) has the molecular formula C13H24N4 and a molecular weight of 236.36 g/mol. Its IUPAC name is N'-[2-[2-aminoethyl(benzyl)amino]ethyl]ethane-1,2-diamine.
| Compound Name | N'-[2-[2-aminoethyl(benzyl)amino]ethyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 101461919 |
| Molecular Formula | C13H24N4 |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.20 |
| IUPAC Name | N'-[2-[2-aminoethyl(benzyl)amino]ethyl]ethane-1,2-diamine |
| SMILES | NCCNCCN(CCN)Cc1ccccc1 |
| InChI | InChI=1S/C13H24N4/c14-6-8-16-9-11-17(10-7-15)12-13-4-2-1-3-5-13/h1-5,16H,6-12,14-15H2 |
| InChIKey | GGEUAFYLRYNIHK-UHFFFAOYSA-N |
| XLogP | -0.00 |
| TPSA | 67.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|