C13H21FN2 — CID 107367851
N'-benzyl-N'-(3-fluoropropyl)propane-1,3-diamine (PubChem CID 107367851) has the molecular formula C13H21FN2 and a molecular weight of 224.32 g/mol. Its IUPAC name is N'-benzyl-N'-(3-fluoropropyl)propane-1,3-diamine.
| Compound Name | N'-benzyl-N'-(3-fluoropropyl)propane-1,3-diamine |
|---|---|
| PubChem CID | 107367851 |
| Molecular Formula | C13H21FN2 |
| Molecular Weight | 224.32 g/mol |
| Exact Mass | 224.17 |
| IUPAC Name | N'-benzyl-N'-(3-fluoropropyl)propane-1,3-diamine |
| SMILES | NCCCN(CCCF)Cc1ccccc1 |
| InChI | InChI=1S/C13H21FN2/c14-8-4-10-16(11-5-9-15)12-13-6-2-1-3-7-13/h1-3,6-7H,4-5,8-12,15H2 |
| InChIKey | IEHXSIGVNFGYEV-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.32 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |