C14H20N2 — CID 107367143
N'-benzyl-N'-but-3-ynylpropane-1,3-diamine (PubChem CID 107367143) has the molecular formula C14H20N2 and a molecular weight of 216.33 g/mol. Its IUPAC name is N'-benzyl-N'-but-3-ynylpropane-1,3-diamine.
| Compound Name | N'-benzyl-N'-but-3-ynylpropane-1,3-diamine |
|---|---|
| PubChem CID | 107367143 |
| Molecular Formula | C14H20N2 |
| Molecular Weight | 216.33 g/mol |
| Exact Mass | 216.16 |
| IUPAC Name | N'-benzyl-N'-but-3-ynylpropane-1,3-diamine |
| SMILES | C#CCCN(CCCN)Cc1ccccc1 |
| InChI | InChI=1S/C14H20N2/c1-2-3-11-16(12-7-10-15)13-14-8-5-4-6-9-14/h1,4-6,8-9H,3,7,10-13,15H2 |
| InChIKey | IRQJNBHSXJXLSR-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.33 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|