C13H19F3N2O — CID 107367846
N'-benzyl-N'-[2-(trifluoromethoxy)ethyl]propane-1,3-diamine (PubChem CID 107367846) has the molecular formula C13H19F3N2O and a molecular weight of 276.30 g/mol. Its IUPAC name is N'-benzyl-N'-[2-(trifluoromethoxy)ethyl]propane-1,3-diamine.
| Compound Name | N'-benzyl-N'-[2-(trifluoromethoxy)ethyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 107367846 |
| Molecular Formula | C13H19F3N2O |
| Molecular Weight | 276.30 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | N'-benzyl-N'-[2-(trifluoromethoxy)ethyl]propane-1,3-diamine |
| SMILES | NCCCN(CCOC(F)(F)F)Cc1ccccc1 |
| InChI | InChI=1S/C13H19F3N2O/c14-13(15,16)19-10-9-18(8-4-7-17)11-12-5-2-1-3-6-12/h1-3,5-6H,4,7-11,17H2 |
| InChIKey | UFSXFYLJKOXWMI-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.30 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |