C15H26N2O2S — CID 107367797
N'-benzyl-N'-(3-ethylsulfonylpropyl)propane-1,3-diamine (PubChem CID 107367797) has the molecular formula C15H26N2O2S and a molecular weight of 298.45 g/mol. Its IUPAC name is N'-benzyl-N'-(3-ethylsulfonylpropyl)propane-1,3-diamine.
| Compound Name | N'-benzyl-N'-(3-ethylsulfonylpropyl)propane-1,3-diamine |
|---|---|
| PubChem CID | 107367797 |
| Molecular Formula | C15H26N2O2S |
| Molecular Weight | 298.45 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | N'-benzyl-N'-(3-ethylsulfonylpropyl)propane-1,3-diamine |
| SMILES | CCS(=O)(=O)CCCN(CCCN)Cc1ccccc1 |
| InChI | InChI=1S/C15H26N2O2S/c1-2-20(18,19)13-7-12-17(11-6-10-16)14-15-8-4-3-5-9-15/h3-5,8-9H,2,6-7,10-14,16H2,1H3 |
| InChIKey | WXKGXNZGAAYMIF-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.45 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |