C34H40N2O2S — CID 68796747
N,N-dibenzyl-3-[3-(dibenzylamino)propylsulfonyl]propan-1-amine (PubChem CID 68796747) has the molecular formula C34H40N2O2S and a molecular weight of 540.77 g/mol. Its IUPAC name is N,N-dibenzyl-3-[3-(dibenzylamino)propylsulfonyl]propan-1-amine.
| Compound Name | N,N-dibenzyl-3-[3-(dibenzylamino)propylsulfonyl]propan-1-amine |
|---|---|
| PubChem CID | 68796747 |
| Molecular Formula | C34H40N2O2S |
| Molecular Weight | 540.77 g/mol |
| Exact Mass | 540.28 |
| IUPAC Name | N,N-dibenzyl-3-[3-(dibenzylamino)propylsulfonyl]propan-1-amine |
| SMILES | O=S(=O)(CCCN(Cc1ccccc1)Cc1ccccc1)CCCN(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C34H40N2O2S/c37-39(38,25-13-23-35(27-31-15-5-1-6-16-31)28-32-17-7-2-8-18-32)26-14-24-36(29-33-19-9-3-10-20-33)30-34-21-11-4-12-22-34/h1-12,15-22H,13-14,23-30H2 |
| InChIKey | PBLXDKKAQZRSMM-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.77 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |