C12H20N2O2S — CID 61014687
N'-benzyl-N'-(2-methylsulfonylethyl)ethane-1,2-diamine (PubChem CID 61014687) has the molecular formula C12H20N2O2S and a molecular weight of 256.37 g/mol. Its IUPAC name is N'-benzyl-N'-(2-methylsulfonylethyl)ethane-1,2-diamine.
| Compound Name | N'-benzyl-N'-(2-methylsulfonylethyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 61014687 |
| Molecular Formula | C12H20N2O2S |
| Molecular Weight | 256.37 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | N'-benzyl-N'-(2-methylsulfonylethyl)ethane-1,2-diamine |
| SMILES | CS(=O)(=O)CCN(CCN)Cc1ccccc1 |
| InChI | InChI=1S/C12H20N2O2S/c1-17(15,16)10-9-14(8-7-13)11-12-5-3-2-4-6-12/h2-6H,7-11,13H2,1H3 |
| InChIKey | PXCJNBPMTPSZGK-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.37 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |