C15H24N2 — CID 107367618
N'-benzyl-N'-(2-methylidenebutyl)propane-1,3-diamine (PubChem CID 107367618) has the molecular formula C15H24N2 and a molecular weight of 232.37 g/mol. Its IUPAC name is N'-benzyl-N'-(2-methylidenebutyl)propane-1,3-diamine.
| Compound Name | N'-benzyl-N'-(2-methylidenebutyl)propane-1,3-diamine |
|---|---|
| PubChem CID | 107367618 |
| Molecular Formula | C15H24N2 |
| Molecular Weight | 232.37 g/mol |
| Exact Mass | 232.19 |
| IUPAC Name | N'-benzyl-N'-(2-methylidenebutyl)propane-1,3-diamine |
| SMILES | C=C(CC)CN(CCCN)Cc1ccccc1 |
| InChI | InChI=1S/C15H24N2/c1-3-14(2)12-17(11-7-10-16)13-15-8-5-4-6-9-15/h4-6,8-9H,2-3,7,10-13,16H2,1H3 |
| InChIKey | RDNZDYJRQKCWPS-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.37 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|