C17H20F2N2 — CID 107365236
N'-benzyl-N'-[(2,6-difluorophenyl)methyl]propane-1,3-diamine (PubChem CID 107365236) has the molecular formula C17H20F2N2 and a molecular weight of 290.36 g/mol. Its IUPAC name is N'-benzyl-N'-[(2,6-difluorophenyl)methyl]propane-1,3-diamine.
| Compound Name | N'-benzyl-N'-[(2,6-difluorophenyl)methyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 107365236 |
| Molecular Formula | C17H20F2N2 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | N'-benzyl-N'-[(2,6-difluorophenyl)methyl]propane-1,3-diamine |
| SMILES | NCCCN(Cc1ccccc1)Cc1c(F)cccc1F |
| InChI | InChI=1S/C17H20F2N2/c18-16-8-4-9-17(19)15(16)13-21(11-5-10-20)12-14-6-2-1-3-7-14/h1-4,6-9H,5,10-13,20H2 |
| InChIKey | WESNJIHACTXSSS-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |