C17H20BrFN2 — CID 107367498
N'-benzyl-N'-[(2-bromo-4-fluorophenyl)methyl]propane-1,3-diamine (PubChem CID 107367498) has the molecular formula C17H20BrFN2 and a molecular weight of 351.26 g/mol. Its IUPAC name is N'-benzyl-N'-[(2-bromo-4-fluorophenyl)methyl]propane-1,3-diamine.
| Compound Name | N'-benzyl-N'-[(2-bromo-4-fluorophenyl)methyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 107367498 |
| Molecular Formula | C17H20BrFN2 |
| Molecular Weight | 351.26 g/mol |
| Exact Mass | 350.08 |
| IUPAC Name | N'-benzyl-N'-[(2-bromo-4-fluorophenyl)methyl]propane-1,3-diamine |
| SMILES | NCCCN(Cc1ccccc1)Cc1ccc(F)cc1Br |
| InChI | InChI=1S/C17H20BrFN2/c18-17-11-16(19)8-7-15(17)13-21(10-4-9-20)12-14-5-2-1-3-6-14/h1-3,5-8,11H,4,9-10,12-13,20H2 |
| InChIKey | WGGKYPOJKWSEGG-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.26 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |