C16H18F2N2 — CID 62197006
N'-benzyl-N'-[(2,4-difluorophenyl)methyl]ethane-1,2-diamine (PubChem CID 62197006) has the molecular formula C16H18F2N2 and a molecular weight of 276.33 g/mol. Its IUPAC name is N'-benzyl-N'-[(2,4-difluorophenyl)methyl]ethane-1,2-diamine.
| Compound Name | N'-benzyl-N'-[(2,4-difluorophenyl)methyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 62197006 |
| Molecular Formula | C16H18F2N2 |
| Molecular Weight | 276.33 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | N'-benzyl-N'-[(2,4-difluorophenyl)methyl]ethane-1,2-diamine |
| SMILES | NCCN(Cc1ccccc1)Cc1ccc(F)cc1F |
| InChI | InChI=1S/C16H18F2N2/c17-15-7-6-14(16(18)10-15)12-20(9-8-19)11-13-4-2-1-3-5-13/h1-7,10H,8-9,11-12,19H2 |
| InChIKey | JODXVSVKOYQBFQ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.33 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |