C16H22N2S — CID 107366906
N'-benzyl-N'-(2-thiophen-2-ylethyl)propane-1,3-diamine (PubChem CID 107366906) has the molecular formula C16H22N2S and a molecular weight of 274.43 g/mol. Its IUPAC name is N'-benzyl-N'-(2-thiophen-2-ylethyl)propane-1,3-diamine.
| Compound Name | N'-benzyl-N'-(2-thiophen-2-ylethyl)propane-1,3-diamine |
|---|---|
| PubChem CID | 107366906 |
| Molecular Formula | C16H22N2S |
| Molecular Weight | 274.43 g/mol |
| Exact Mass | 274.15 |
| IUPAC Name | N'-benzyl-N'-(2-thiophen-2-ylethyl)propane-1,3-diamine |
| SMILES | NCCCN(CCc1cccs1)Cc1ccccc1 |
| InChI | InChI=1S/C16H22N2S/c17-10-5-11-18(12-9-16-8-4-13-19-16)14-15-6-2-1-3-7-15/h1-4,6-8,13H,5,9-12,14,17H2 |
| InChIKey | MCXNMTIJTMDRBA-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.43 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |