C18H25ClN2OS — CID 120649485
N-(3-aminopropyl)-N-benzyl-4-thiophen-2-ylbutanamide;hydrochloride (PubChem CID 120649485) has the molecular formula C18H25ClN2OS and a molecular weight of 352.93 g/mol. Its IUPAC name is N-(3-aminopropyl)-N-benzyl-4-thiophen-2-ylbutanamide;hydrochloride.
| Compound Name | N-(3-aminopropyl)-N-benzyl-4-thiophen-2-ylbutanamide;hydrochloride |
|---|---|
| PubChem CID | 120649485 |
| Molecular Formula | C18H25ClN2OS |
| Molecular Weight | 352.93 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | N-(3-aminopropyl)-N-benzyl-4-thiophen-2-ylbutanamide;hydrochloride |
| SMILES | Cl.NCCCN(Cc1ccccc1)C(=O)CCCc1cccs1 |
| InChI | InChI=1S/C18H24N2OS.ClH/c19-12-6-13-20(15-16-7-2-1-3-8-16)18(21)11-4-9-17-10-5-14-22-17;/h1-3,5,7-8,10,14H,4,6,9,11-13,15,19H2;1H |
| InChIKey | QVVCVZHKNMVMGO-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.93 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |