C14H19N3S — CID 107365130
N'-benzyl-N'-(1,3-thiazol-2-ylmethyl)propane-1,3-diamine (PubChem CID 107365130) has the molecular formula C14H19N3S and a molecular weight of 261.39 g/mol. Its IUPAC name is N'-benzyl-N'-(1,3-thiazol-2-ylmethyl)propane-1,3-diamine.
| Compound Name | N'-benzyl-N'-(1,3-thiazol-2-ylmethyl)propane-1,3-diamine |
|---|---|
| PubChem CID | 107365130 |
| Molecular Formula | C14H19N3S |
| Molecular Weight | 261.39 g/mol |
| Exact Mass | 261.13 |
| IUPAC Name | N'-benzyl-N'-(1,3-thiazol-2-ylmethyl)propane-1,3-diamine |
| SMILES | NCCCN(Cc1ccccc1)Cc1nccs1 |
| InChI | InChI=1S/C14H19N3S/c15-7-4-9-17(12-14-16-8-10-18-14)11-13-5-2-1-3-6-13/h1-3,5-6,8,10H,4,7,9,11-12,15H2 |
| InChIKey | OHEQOWMPEZVCJZ-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.39 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |