C32H37N7OS2 — CID 167528390
4-[3,5-bis[[pyridin-2-ylmethyl(1,3-thiazol-2-ylmethyl)amino]methyl]phenoxy]butan-1-amine (PubChem CID 167528390) has the molecular formula C32H37N7OS2 and a molecular weight of 599.83 g/mol. Its IUPAC name is 4-[3,5-bis[[pyridin-2-ylmethyl(1,3-thiazol-2-ylmethyl)amino]methyl]phenoxy]butan-1-amine.
| Compound Name | 4-[3,5-bis[[pyridin-2-ylmethyl(1,3-thiazol-2-ylmethyl)amino]methyl]phenoxy]butan-1-amine |
|---|---|
| PubChem CID | 167528390 |
| Molecular Formula | C32H37N7OS2 |
| Molecular Weight | 599.83 g/mol |
| Exact Mass | 599.25 |
| IUPAC Name | 4-[3,5-bis[[pyridin-2-ylmethyl(1,3-thiazol-2-ylmethyl)amino]methyl]phenoxy]butan-1-amine |
| SMILES | NCCCCOc1cc(CN(Cc2ccccn2)Cc2nccs2)cc(CN(Cc2ccccn2)Cc2nccs2)c1 |
| InChI | InChI=1S/C32H37N7OS2/c33-9-3-6-14-40-30-18-26(20-38(24-31-36-12-15-41-31)22-28-7-1-4-10-34-28)17-27(19-30)21-39(25-32-37-13-16-42-32)23-29-8-2-5-11-35-29/h1-2,4-5,7-8,10-13,15-19H,3,6,9,14,20-25,33H2 |
| InChIKey | ARIRIFYISRREID-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 93.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.83 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|