C43H50N6O4 — CID 159619758
ethyl 9-[3,5-bis[[bis(pyridin-2-ylmethyl)amino]methyl]phenoxy]-4-oxononanoate (PubChem CID 159619758) has the molecular formula C43H50N6O4 and a molecular weight of 714.91 g/mol. Its IUPAC name is ethyl 9-[3,5-bis[[bis(pyridin-2-ylmethyl)amino]methyl]phenoxy]-4-oxononanoate.
| Compound Name | ethyl 9-[3,5-bis[[bis(pyridin-2-ylmethyl)amino]methyl]phenoxy]-4-oxononanoate |
|---|---|
| PubChem CID | 159619758 |
| Molecular Formula | C43H50N6O4 |
| Molecular Weight | 714.91 g/mol |
| Exact Mass | 714.39 |
| IUPAC Name | ethyl 9-[3,5-bis[[bis(pyridin-2-ylmethyl)amino]methyl]phenoxy]-4-oxononanoate |
| SMILES | CCOC(=O)CCC(=O)CCCCCOc1cc(CN(Cc2ccccn2)Cc2ccccn2)cc(CN(Cc2ccccn2)Cc2ccccn2)c1 |
| InChI | InChI=1S/C43H50N6O4/c1-2-52-43(51)20-19-41(50)18-4-3-13-25-53-42-27-35(29-48(31-37-14-5-9-21-44-37)32-38-15-6-10-22-45-38)26-36(28-42)30-49(33-39-16-7-11-23-46-39)34-40-17-8-12-24-47-40/h5-12,14-17,21-24,26-28H,2-4,13,18-20,25,29-34H2,1H3 |
| InChIKey | MNSYKHBMRGXRBI-UHFFFAOYSA-N |
| XLogP | 7.52 |
| TPSA | 110.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.91 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|