C19H25N3O2 — CID 138976785
methyl 6-[bis(pyridin-2-ylmethyl)amino]hexanoate (PubChem CID 138976785) has the molecular formula C19H25N3O2 and a molecular weight of 327.43 g/mol. Its IUPAC name is methyl 6-[bis(pyridin-2-ylmethyl)amino]hexanoate.
| Compound Name | methyl 6-[bis(pyridin-2-ylmethyl)amino]hexanoate |
|---|---|
| PubChem CID | 138976785 |
| Molecular Formula | C19H25N3O2 |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.19 |
| IUPAC Name | methyl 6-[bis(pyridin-2-ylmethyl)amino]hexanoate |
| SMILES | COC(=O)CCCCCN(Cc1ccccn1)Cc1ccccn1 |
| InChI | InChI=1S/C19H25N3O2/c1-24-19(23)11-3-2-8-14-22(15-17-9-4-6-12-20-17)16-18-10-5-7-13-21-18/h4-7,9-10,12-13H,2-3,8,11,14-16H2,1H3 |
| InChIKey | FQFJZLLXALCPFH-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|